CAS 106666-00-6
:4-Acetoxynisoldipine
Description:
4-Acetoxynisoldipine is a chemical compound that belongs to the class of calcium channel blockers, specifically a dihydropyridine derivative. It is primarily characterized by its ability to inhibit calcium influx through L-type calcium channels, which plays a crucial role in vascular smooth muscle contraction and cardiac muscle function. This compound is often studied for its potential therapeutic applications in treating hypertension and angina pectoris. Structurally, it features an acetoxy group, which contributes to its pharmacological properties and solubility. The compound is typically administered in a specific dosage form to achieve desired therapeutic effects while minimizing side effects. As with many pharmaceuticals, its safety profile, including potential interactions and contraindications, is an important consideration in clinical settings. Research continues to explore its efficacy and mechanisms of action, as well as its potential benefits in various cardiovascular conditions.
Formula:C22H26N2O8
InChI:InChI=1/C22H26N2O8/c1-12-17(20(26)30-6)19(15-9-7-8-10-16(15)24(28)29)18(13(2)23-12)21(27)31-11-22(4,5)32-14(3)25/h7-10,19,23H,11H2,1-6H3
SMILES:CC1=C(C(c2ccccc2N(=O)=O)C(=C(C)N1)C(=O)OCC(C)(C)OC(=O)C)C(=O)OC
Synonyms:- 1,4-Dihydro-2,6-dimethyl-4-(2-nitrophenyl)-3,5-pyridinedicarboxylic Acid 2-Acetoxy-2-methyl-propyl Methyl Este
- 1,4-Dihydro-2,6-dimethyl-4-(2-nitrophenyl)-3,5-pyridinedicarboxylic Acid 2-Acetoxy-2-methyl-propyl Methyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Acetoxynisoldipine
CAS:Controlled Product<p>Applications Useful as vasodilators, antihypertensives, and spasmolytics.<br></p>Formula:C22H26N2O8Color and Shape:NeatMolecular weight:446.45
