CAS 106670-34-2
:2-[(4-METHYLBENZYL)THIO]ETHANAMINE
Description:
2-[(4-Methylbenzyl)thio]ethanamine, identified by its CAS number 106670-34-2, is an organic compound characterized by the presence of both an amine and a thioether functional group. This compound features a two-carbon ethyl chain linked to a thiol group (–S–) that is further substituted with a 4-methylbenzyl group, which contributes to its hydrophobic characteristics. The presence of the methyl group on the benzyl ring enhances its lipophilicity, potentially influencing its solubility in organic solvents. The amine group imparts basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Safety and handling considerations should be observed, as with many amines and thiols, due to their potential reactivity and toxicity.
Formula:C10H16NS
InChI:InChI=1/C10H15NS/c1-9-2-4-10(5-3-9)8-12-7-6-11/h2-5H,6-8,11H2,1H3/p+1
Synonyms:- Ethanamine, 2-[[(4-Methylphenyl)Methyl]Thio]-
- 2-[(4-Methylbenzyl)Sulfanyl]Ethanamine
- 2-[(4-Methylbenzyl)Sulfanyl]Ethanaminium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.