CymitQuimica logo

CAS 106671-84-5

:

2-fluorolinalyl pyrophosphate

Description:
2-Fluorolinalyl pyrophosphate is a chemical compound characterized by its structure, which includes a fluorine atom and a pyrophosphate group. This compound is part of the class of organophosphates, which are known for their role in various biological processes and applications, particularly in agriculture and biochemistry. The presence of the fluorine atom can influence the reactivity and biological activity of the molecule, potentially enhancing its stability or altering its interaction with enzymes and receptors. Pyrophosphate groups are often involved in energy transfer and signaling processes in living organisms. As a synthetic compound, 2-fluorolinalyl pyrophosphate may be studied for its potential applications in medicinal chemistry or as a biochemical tool. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with organophosphate compounds. Overall, the unique characteristics of 2-fluorolinalyl pyrophosphate make it a subject of interest in both research and practical applications within the fields of chemistry and biology.
Formula:C10H19FO7P2
InChI:InChI=1/C10H19FO7P2/c1-8(2)6-5-7-10(4,9(3)11)17-20(15,16)18-19(12,13)14/h6H,3,5,7H2,1-2,4H3,(H,15,16)(H2,12,13,14)
SMILES:CC(=CCCC(C)(C(=C)F)OP(=O)(O)OP(=O)(O)O)C
Synonyms:
  • 2-Flpp
  • 2-Fluoro-3,7-Dimethylocta-1,6-Dien-3-Yl Trihydrogen Diphosphate
  • 2-Fluorolinalyl pyrophosphate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.