CymitQuimica logo

CAS 106675-70-1

:

N,N'-Dimethoxy-N,N'-dimethyloxamide

Description:
N,N'-Dimethoxy-N,N'-dimethyloxamide is an organic compound characterized by its oxamide functional group, which consists of two amide linkages. This compound features two methoxy groups and two methyl groups attached to the nitrogen atoms, contributing to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in organic solvents due to the presence of the methoxy groups, which enhance its polarity. The presence of the oxamide structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to form hydrogen bonds and interact with biological systems. Additionally, the compound may exhibit interesting thermal and chemical stability, making it suitable for specific synthetic applications. However, detailed information regarding its reactivity, toxicity, and specific applications may require further investigation through experimental studies and safety data sheets. As with all chemical substances, proper handling and safety precautions should be observed when working with N,N'-Dimethoxy-N,N'-dimethyloxamide.
Formula:C6H12N2O4
InChI:InChI=1/C6H12N2O4/c1-7(11-3)5(9)6(10)8(2)12-4/h1-4H3
InChI key:OXSWGKZLVLVHIS-UHFFFAOYSA-N
SMILES:CN(C(=O)C(=O)N(C)OC)OC
Synonyms:
  • N,N'-Oxalylbis[Methoxy(Methyl)Amine]
  • N,N'-dimethoxy-N,N'-dimethylethanediamide
Found 5 products.