CAS 106685-66-9

3-Oxobutanoic Acid 2-Acetoxy-2-methylpropyl Ester

Description:

3-Oxobutanoic Acid 2-Acetoxy-2-methylpropyl Ester, with the CAS number 106685-66-9, is an organic compound characterized by its ester functional group, which is derived from the reaction of 3-oxobutanoic acid and 2-acetoxy-2-methylpropanol. This compound typically exhibits a moderate molecular weight and is likely to be a colorless to pale yellow liquid at room temperature. It is soluble in organic solvents, reflecting its ester nature, while its polar functional groups may impart some degree of solubility in water. The presence of the ketone group (3-oxobutanoic acid) suggests potential reactivity in condensation reactions or as a precursor in synthetic organic chemistry. Additionally, the ester moiety may influence its volatility and reactivity, making it useful in various applications, including as an intermediate in organic synthesis or in the formulation of fragrances and flavors. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₀H₁₆O₅

InChI: InChI=1/C10H16O5/c1-7(11)5-9(13)14-6-10(3,4)15-8(2)12/h5-6H2,1-4H3

SMILES: CC(=O)CC(=O)OCC(C)(C)OC(=O)C

Synonyms:

• 3-Oxo-butanoic Acid 2-(Acetyloxy)-2-methylpropyl Ester