CAS 106685-67-0

2-(Acetyloxy)-2-methylpropyl 2-[(2-nitrophenyl)methylene]-3-oxobutanoate

Description:

2-(Acetyloxy)-2-methylpropyl 2-[(2-nitrophenyl)methylene]-3-oxobutanoate, with the CAS number 106685-67-0, is a synthetic organic compound that features a complex structure characterized by multiple functional groups. It contains an acetyloxy group, which contributes to its reactivity and solubility properties, and a nitrophenyl moiety that may impart specific electronic characteristics and potential biological activity. The presence of the 3-oxobutanoate structure suggests that it may participate in various chemical reactions, including esterification and condensation reactions. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic and hydrophilic groups, influencing its solubility in organic solvents and water. Additionally, the nitro group can enhance the compound's reactivity, making it a candidate for further chemical transformations or applications in medicinal chemistry. Overall, the unique combination of functional groups in this compound may lead to interesting properties and potential uses in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₇H₁₉NO₇

InChI: InChI=1S/C17H19NO7/c1-11(19)14(9-13-7-5-6-8-15(13)18(22)23)16(21)24-10-17(3,4)25-12(2)20/h5-9H,10H2,1-4H3

InChI key: InChIKey=FFIBYMHZCNFTRU-UHFFFAOYSA-N

SMILES: C(=C(C(OCC(OC(C)=O)(C)C)=O)C(C)=O)C1=C(N(=O)=O)C=CC=C1

Synonyms:

• 2-(Acetyloxy)-2-methylpropyl 2-[(2-nitrophenyl)methylene]-3-oxobutanoate
• 2-[(2-Nitrophenyl)methylene]-3-oxo-butanoic Acid 2-(Acetyloxy)-2-methylpropyl Este
• 2-[(2-Nitrophenyl)methylene]-3-oxo-butanoic Acid 2-(Acetyloxy)-2-methylpropyl Ester
• Butanoic acid, 2-[(2-nitrophenyl)methylene]-3-oxo-, 2-(acetyloxy)-2-methylpropyl ester
• 2-(2-Nitrobenzylidene)-3-oxobutanoic Acid 2-Acetoxy-2-methylpropyl Ester