CAS 106690-33-9

(1,3-benzodioxol-5-yloxy)acetic acid

Description:

(1,3-benzodioxol-5-yloxy)acetic acid, with the CAS number 106690-33-9, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which can influence its solubility, reactivity, and potential applications. The presence of the benzodioxole ring often imparts certain biological activities, making it of interest in medicinal chemistry. It may exhibit moderate polarity due to the carboxylic acid group, affecting its solubility in various solvents. Additionally, the compound can participate in hydrogen bonding due to the acidic hydrogen, which may enhance its interactions with biological targets. Its synthesis may involve standard organic reactions, and it can serve as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. Overall, (1,3-benzodioxol-5-yloxy)acetic acid is a compound of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₉H₈O₅

InChI: InChI=1/C9H8O5/c10-9(11)4-12-6-1-2-7-8(3-6)14-5-13-7/h1-3H,4-5H2,(H,10,11)

SMILES: c1cc2c(cc1OCC(=O)O)OCO2

Synonyms:

• Acetic Acid, 2-(1,3-Benzodioxol-5-Yloxy)-

(1,3-benzodioxol-5-yloxy)acetic acid

CAS: 106690-33-9

Formula: C₉H₈O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.1568

Ref: IN-DA007BVV

2-(Benzo[d][1,3]dioxol-5-yloxy)acetic acid

CAS: 106690-33-9

2-(Benzo[d][1,3]dioxol-5-yloxy)acetic acid

Purity: 98%

Molecular weight: 196.16g/mol

Ref: 54-OR1031834

(Benzo[1,3]dioxol-5-yloxy)-acetic acid

CAS: 106690-33-9

Formula: C₉H₈O₅

Purity: 98%

Molecular weight: 196.158

Ref: 10-F059837