CAS 106692-36-8
:N-[3-(2-Oxo-1-pyrrolidinyl)propyl]acetamide
Description:
N-[3-(2-Oxo-1-pyrrolidinyl)propyl]acetamide, with the CAS number 106692-36-8, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by its amide functional group, which contributes to its potential as a bioactive molecule. The presence of the 2-oxo group indicates that it may exhibit keto-enol tautomerism, influencing its reactivity and interactions. The propyl chain attached to the nitrogen atom of the pyrrolidine ring suggests that it may have hydrophobic characteristics, which can affect its solubility and permeability in biological systems. This compound may be of interest in medicinal chemistry due to its structural features that could interact with biological targets, potentially leading to pharmacological applications. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, N-[3-(2-Oxo-1-pyrrolidinyl)propyl]acetamide represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C9H16N2O2
InChI:InChI=1/C9H16N2O2/c1-8(12)10-5-3-7-11-6-2-4-9(11)13/h2-7H2,1H3,(H,10,12)
InChI key:InChIKey=OAUYENAPBFTAQT-UHFFFAOYSA-N
SMILES:C(CCNC(C)=O)N1C(=O)CCC1
Synonyms:- N-(3-Acetamidopropyl)pyrrolidin-2-one
- N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide
- Acisoga
- Acetamide, N-(3-(2-oxo-1-pyrrolidinyl)propyl)-
- N-[3-(2-Oxo-1-pyrrolidinyl)propyl]acetamide
- Acetamide, N-[3-(2-oxo-1-pyrrolidinyl)propyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-[3-(2-Oxopyrrolidin-1-yl)propyl]acetamide
CAS:<p>N-[3-(2-Oxopyrrolidin-1-yl)propyl]acetamide is a chemotherapeutic treatment that has been shown to be effective against infant cancer. It is a selective inhibitor of the enzyme adenosine kinase, which is involved in the regulation of cell proliferation and differentiation. N-[3-(2-Oxopyrrolidin-1-yl)propyl]acetamide has also been shown to have antiarrhythmic properties, which may be due to its ability to inhibit atrial natriuretic peptide and potassium currents. This drug has been shown to produce metabolic profiles that are similar to those observed in chronic kidney disease patients with diabetes mellitus. N-[3-(2-Oxopyrrolidin-1-yl)propyl]acetamide also shows diagnostic potential for the diagnosis of atrial arrhythmias, as it can identify patients with atrial fibrillation or atrial flutter</p>Formula:C9H16N2O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:184.24 g/mol
