
CAS 1067192-38-4
:1-(3-Aminophenyl)cyclopentanecarbonitrile
Description:
1-(3-Aminophenyl)cyclopentanecarbonitrile, identified by its CAS number 1067192-38-4, is a chemical compound characterized by its unique structure that includes a cyclopentane ring, an amino group, and a nitrile functional group. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The nitrile group contributes to the compound's polarity and can influence its solubility in organic solvents. This compound may exhibit biological activity, which is often explored in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the cyclopentane and phenyl groups. Overall, 1-(3-Aminophenyl)cyclopentanecarbonitrile represents a versatile scaffold for further chemical exploration and application in various fields, including organic synthesis and medicinal chemistry.
Formula:C12H14N2
InChI:InChI=1S/C12H14N2/c13-9-12(6-1-2-7-12)10-4-3-5-11(14)8-10/h3-5,8H,1-2,6-7,14H2
InChI key:InChIKey=QHBLQEJWJAYRBK-UHFFFAOYSA-N
SMILES:C(#N)C1(CCCC1)C2=CC(N)=CC=C2
Synonyms:- 1-(3-Aminophenyl)cyclopentane-1-carbonitrile
- Cyclopentanecarbonitrile, 1-(3-aminophenyl)-
- 1-(3-Aminophenyl)cyclopentanecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.