CymitQuimica logo

CAS 1067193-34-3

:

5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:
5-Fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a fluorine atom at the 5-position enhances its reactivity and can influence its biological activity. The carboxylic acid functional group at the 3-position provides acidic properties, making it capable of participating in various chemical reactions, such as esterification and amidation. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its structural features may allow for interactions with biological macromolecules, making it a candidate for further investigation in pharmacological studies. Additionally, the compound's solubility and stability can be influenced by the presence of the fluorine atom and the carboxylic acid group, which are important factors in its application in various chemical and biological contexts.
Formula:C8H5FN2O2
InChI:InChI=1S/C8H5FN2O2/c9-4-1-5-6(8(12)13)3-11-7(5)10-2-4/h1-3H,(H,10,11)(H,12,13)
InChI key:QPXLPJIMEKHJJA-UHFFFAOYSA-N
SMILES:C1=C(C=NC2=C1C(=CN2)C(=O)O)F
Found 4 products.