CAS 1067193-36-5: 5-Chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid
Description:5-Chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position and a carboxylic acid functional group at the 3-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits moderate stability under standard conditions but may be sensitive to strong acids or bases due to the presence of the carboxylic acid group. It is often utilized in medicinal chemistry and drug development, particularly in the synthesis of biologically active molecules. The compound's structure allows for potential interactions with biological targets, making it of interest in pharmacological research. Additionally, its molecular characteristics may influence its behavior in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 5-Chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is a versatile compound with significant implications in organic synthesis and medicinal applications.
Formula:C8H5ClN2O2
InChI:InChI=1S/C8H5ClN2O2/c9-7-1-4-5(8(12)13)2-10-6(4)3-11-7/h1-3,10H,(H,12,13)
InChI key:InChIKey=AVPUJBXNXVWMSX-UHFFFAOYSA-N
SMILES:O=C(O)C1=CNC=2C=NC(Cl)=CC21
- Synonyms:
- 1H-Pyrrolo[2,3-c]pyridine-3-carboxylic acid, 5-chloro-
- 5-Chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid

5-Chloro-6-azaindole-3-carboxylic acid
Ref: IN-DA008XQN
1g | To inquire | ||
100mg | 208.00 € | ||
250mg | 347.00 € | ||
500mg | 628.00 € |

5-Chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid
Ref: 54-OR86809
1g | 1,251.00 € | ||
100mg | 363.00 € | ||
250mg | 584.00 € |

5-Chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid
Ref: 10-F337398
1g | 691.00 € | ||
100mg | 192.00 € | ||
250mg | 307.00 € |

5-Chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid
Ref: 3D-SSB19336
50mg | 402.00 € | ||
500mg | 993.00 € |