CAS 1067225-49-3

4-Fluoro-2-(methoxymethoxy)-1-methylbenzene

Description:

4-Fluoro-2-(methoxymethoxy)-1-methylbenzene, also known by its CAS number 1067225-49-3, is an organic compound characterized by the presence of a fluorine atom and methoxymethoxy functional groups attached to a methyl-substituted benzene ring. This compound features a fluorobenzene structure, which typically enhances its reactivity and influences its physical properties, such as boiling and melting points. The methoxymethoxy group introduces ether characteristics, contributing to the compound's solubility in organic solvents and potentially affecting its polarity. The presence of the methyl group on the benzene ring can also influence steric hindrance and electronic distribution, impacting its reactivity in various chemical reactions. Overall, this compound may be of interest in fields such as medicinal chemistry and materials science, where fluorinated compounds often exhibit unique biological and physical properties. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature review.

Formula: C₉H₁₁FO₂

InChI: InChI=1S/C9H11FO2/c1-7-3-4-8(10)5-9(7)12-6-11-2/h3-5H,6H2,1-2H3

InChI key: InChIKey=AJDFURMBGOGECG-UHFFFAOYSA-N

SMILES: O(COC)C1=C(C)C=CC(F)=C1

Synonyms:

• 4-Fluoro-2-(methoxymethoxy)-1-methylbenzene
• 4-Fluoro-1-methyl-2-[[(methyloxy)methyl]oxy]benzene
• Benzene, 4-fluoro-2-(methoxymethoxy)-1-methyl-

Benzene, 4-fluoro-2-(methoxymethoxy)-1-methyl-

CAS: 1067225-49-3

Formula: C₉H₁₁FO₂

Purity: 95%

Molecular weight: 170.1808

Ref: IN-DA01K5GJ