CAS 106750-00-9
:differolide
Description:
Differolide, with the CAS number 106750-00-9, is a naturally occurring compound classified as a sesquiterpene lactone. It is primarily derived from certain plant species, particularly those in the Asteraceae family. Differolide is characterized by its unique bicyclic structure, which contributes to its biological activity. This compound exhibits a range of pharmacological properties, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in medicinal chemistry and natural product research. Differolide's mechanism of action often involves the modulation of various cellular pathways, although specific details may vary depending on the biological context. Its solubility and stability can be influenced by environmental factors, which are important considerations for its application in therapeutic settings. Overall, differentiolide represents a significant area of study for researchers exploring natural compounds with potential health benefits.
Formula:C12H12O4
InChI:InChI=1/C12H12O4/c13-11-9(4-5-15-11)7-2-1-3-8-10(7)6-16-12(8)14/h3-4,7,10H,1-2,5-6H2/t7-,10+/m0/s1
Synonyms:- (3aR,4R)-4-(2-oxo-2,5-dihydrofuran-3-yl)-3a,4,5,6-tetrahydro-2-benzofuran-1(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
