CAS 106778-43-2

6-Isoquinolinecarboxylic acid

Description:

6-Isoquinolinecarboxylic acid is an aromatic carboxylic acid characterized by its isoquinoline structure, which consists of a fused bicyclic system containing a nitrogen atom. This compound typically exhibits properties common to carboxylic acids, such as the ability to form hydrogen bonds, which influences its solubility in polar solvents. It is generally soluble in organic solvents and may have limited solubility in water, depending on the pH. The presence of the carboxylic acid functional group contributes to its acidity, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, 6-Isoquinolinecarboxylic acid may serve as a building block in organic synthesis and has potential applications in pharmaceuticals and agrochemicals due to its structural features that can interact with biological targets. Its unique isoquinoline framework may also impart specific biological activities, making it of interest in medicinal chemistry. As with many chemical substances, safety data should be consulted to ensure proper handling and usage.

Formula: C₁₀H₇NO₂

InChI: InChI=1S/C10H7NO2/c12-10(13)8-1-2-9-6-11-4-3-7(9)5-8/h1-6H,(H,12,13)

InChI key: InChIKey=ADAHADRJWVCICR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC2=C(C=C1)C=NC=C2

Synonyms:

• Isoquinoline-6-Carboxylic Acid
• 6-Isoquinolinecarboxylic acid

6-Isoquinolinecarboxylic Acid

CAS: 106778-43-2

Formula: C₁₀H₇NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 173.1681

Ref: IN-DA0034D7

Isoquinoline-6-carboxylic acid

CAS: 106778-43-2

Isoquinoline-6-carboxylic acid

Formula: C₁₀H₇NO₂

Purity: ≥95%

Color and Shape: light yellow powder

Molecular weight: 173.17g/mol

Ref: 54-OR48100

6-Isoquinolinecarboxylic acid

CAS: 106778-43-2

Formula: C₁₀H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 173.171

Ref: 10-F223438