CAS 106791-38-2

3-Bromo-2,5-dimethoxy-α-methylbenzeneethanamine

Description:

3-Bromo-2,5-dimethoxy-α-methylbenzeneethanamine, also known by its chemical structure, is a substituted phenethylamine derivative. This compound features a bromine atom and two methoxy groups attached to a benzene ring, along with an ethylamine side chain. The presence of the bromine atom contributes to its reactivity, while the methoxy groups can influence its electronic properties and solubility. Typically, such compounds may exhibit psychoactive properties, as many phenethylamines do, and can interact with various neurotransmitter systems in the brain. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, the specific biological activity, toxicity, and pharmacokinetics of this compound would require further investigation through empirical studies. As with many synthetic compounds, safety and regulatory considerations are paramount, especially given the potential for misuse in recreational contexts. Overall, 3-Bromo-2,5-dimethoxy-α-methylbenzeneethanamine represents a complex chemical entity with diverse implications in both research and application.

Formula: C₁₁H₁₆BrNO₂

InChI: InChI=1S/C11H16BrNO2/c1-7(13)4-8-5-9(14-2)6-10(12)11(8)15-3/h5-7H,4,13H2,1-3H3

InChI key: InChIKey=HCZXNFSMGJKVHO-UHFFFAOYSA-N

SMILES: C(C(C)N)C1=C(OC)C(Br)=CC(OC)=C1

Synonyms:

• 1-(3-Bromo-2,5-dimethoxyphenyl)propan-2-amine
• SL 7161
• 3-Bromo-2,5-dimethoxy-α-methylbenzeneethanamine
• Benzeneethanamine, 3-bromo-2,5-dimethoxy-α-methyl-