CAS 1067914-33-3

4-(2-Methoxyethoxy)-2-pyridinamine

Description:

4-(2-Methoxyethoxy)-2-pyridinamine, identified by its CAS number 1067914-33-3, is an organic compound featuring a pyridine ring substituted with an amino group and a methoxyethoxy side chain. This compound typically exhibits characteristics common to amines and heterocyclic compounds, such as moderate solubility in polar solvents due to the presence of the amino and ether functional groups. The methoxyethoxy group enhances its hydrophilicity, potentially influencing its reactivity and interaction with biological systems. The pyridine moiety contributes to its aromaticity and may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in pharmaceuticals, particularly in the design of compounds targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of the substance would need to be assessed in practical applications.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1S/C8H12N2O2/c1-11-4-5-12-7-2-3-10-8(9)6-7/h2-3,6H,4-5H2,1H3,(H2,9,10)

InChI key: InChIKey=HBBYDTFNQNAFJA-UHFFFAOYSA-N

SMILES: O(CCOC)C=1C=C(N)N=CC1

Synonyms:

• 4-(2-Methoxyethoxy)pyridin-2-ylamine
• 4-(2-Methoxyethoxy)pyridin-2-amine
• 2-Pyridinamine, 4-(2-methoxyethoxy)-
• 4-(2-Methoxyethoxy)-2-pyridinamine