CAS 106795-65-7
:cyclohexyl-(2-fluorophenyl)methanone
Description:
Cyclohexyl-(2-fluorophenyl)methanone, with the CAS number 106795-65-7, is an organic compound characterized by its unique structure, which includes a cyclohexyl group and a 2-fluorophenyl moiety attached to a carbonyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the fluorine atom in the phenyl ring can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering electronic properties. Cyclohexyl-(2-fluorophenyl)methanone may exhibit moderate to low solubility in water but is generally soluble in organic solvents such as ethanol and dichloromethane. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C13H15FO
InChI:InChI=1/C13H15FO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2
SMILES:C1CCC(CC1)C(=O)c1ccccc1F
Synonyms:- Methanone, Cyclohexyl(2-Fluorophenyl)-
- Cyclohexyl(2-fluorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.