CAS 106795-72-6
:1-(2-FLUOROPHENYL)CYCLOHEXANECARBONITRILE
Description:
1-(2-Fluorophenyl)cyclohexanecarbonitrile, with the CAS number 106795-72-6, is an organic compound characterized by its cyclohexane structure substituted with a fluorophenyl group and a carbonitrile functional group. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. The carbonitrile group (-C≡N) is known for its polar nature, contributing to the compound's overall polarity and making it useful in various chemical reactions, including nucleophilic additions and as a precursor in organic synthesis. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the potential toxicity associated with nitriles and halogenated compounds.
Formula:C13H14FN
InChI:InChI=1/C13H14FN/c14-12-7-3-2-6-11(12)13(10-15)8-4-1-5-9-13/h2-3,6-7H,1,4-5,8-9H2
SMILES:C1CCC(CC1)(C#N)c1ccccc1F
Synonyms:- 1-(2-Fluorophenyl)Cyclohexanecarbonitrile 95%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.