CAS 106800-27-5
:4-Hydroxy-2-methoxybenzenepropanol
Description:
4-Hydroxy-2-methoxybenzenepropanol, also known by its CAS number 106800-27-5, is an organic compound characterized by its aromatic structure, which includes a hydroxyl group (-OH) and a methoxy group (-OCH3) attached to a benzene ring. This compound features a propanol side chain, contributing to its alcohol functionality. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both hydroxyl and methoxy groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility in polar solvents. This compound may be of interest in various applications, including pharmaceuticals, where it could serve as an intermediate in the synthesis of more complex molecules. Its chemical properties, such as reactivity and stability, would be influenced by the functional groups present, making it a candidate for further study in organic synthesis and medicinal chemistry. Safety data and handling precautions should be consulted due to potential health effects associated with exposure to similar organic compounds.
Formula:C10H14O3
InChI:InChI=1S/C10H14O3/c1-13-10-7-9(12)5-4-8(10)3-2-6-11/h4-5,7,11-12H,2-3,6H2,1H3
InChI key:InChIKey=TZTSCXBIEBKHBQ-UHFFFAOYSA-N
SMILES:C(CCO)C1=C(OC)C=C(O)C=C1
Synonyms:- 4-Hydroxy-2-methoxybenzenepropanol
- Benzenepropanol, 4-hydroxy-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
