CAS 106800-29-7
:3-Hydroxy-2-methoxybenzenepropanol
Description:
3-Hydroxy-2-methoxybenzenepropanol, also known by its CAS number 106800-29-7, is an organic compound characterized by its aromatic structure and the presence of both hydroxyl and methoxy functional groups. This compound features a propanol backbone, which contributes to its solubility properties. The hydroxyl group (-OH) typically imparts polar characteristics, enhancing its interaction with water and other polar solvents, while the methoxy group (-OCH3) can influence its reactivity and stability. The presence of the benzene ring provides a degree of hydrophobicity, which can affect its overall behavior in biological systems and chemical reactions. This compound may exhibit various biological activities, making it of interest in pharmaceutical and chemical research. Its specific applications and interactions would depend on its structural features and the context of use, such as in drug formulation or as a chemical intermediate. Safety and handling considerations should be taken into account, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C10H14O3
InChI:InChI=1S/C10H14O3/c1-13-10-8(5-3-7-11)4-2-6-9(10)12/h2,4,6,11-12H,3,5,7H2,1H3
InChI key:InChIKey=FQSLHOOPLCDRLL-UHFFFAOYSA-N
SMILES:C(CCO)C1=C(OC)C(O)=CC=C1
Synonyms:- 3-Hydroxy-2-methoxybenzenepropanol
- Benzenepropanol, 3-hydroxy-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
