
CAS 106800-32-2
:3-Hydroxy-2,4-dimethoxybenzenepropanol
Description:
3-Hydroxy-2,4-dimethoxybenzenepropanol, with the CAS number 106800-32-2, is an organic compound characterized by its aromatic structure and the presence of hydroxyl and methoxy functional groups. This compound features a propanol side chain attached to a benzene ring that is further substituted with two methoxy groups at the 2 and 4 positions, and a hydroxyl group at the 3 position. The presence of these functional groups contributes to its potential solubility in polar solvents and may influence its reactivity and biological activity. The methoxy groups can enhance the compound's lipophilicity, while the hydroxyl group can participate in hydrogen bonding, affecting its physical properties such as melting and boiling points. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development or as a precursor in organic synthesis. However, specific data regarding its toxicity, stability, and reactivity would require further investigation and analysis.
Formula:C11H16O4
InChI:InChI=1S/C11H16O4/c1-14-9-6-5-8(4-3-7-12)11(15-2)10(9)13/h5-6,12-13H,3-4,7H2,1-2H3
InChI key:InChIKey=ITUHTOFWFKDUIM-UHFFFAOYSA-N
SMILES:O(C)C1=C(CCCO)C=CC(OC)=C1O
Synonyms:- Benzenepropanol, 3-hydroxy-2,4-dimethoxy-
- 3-Hydroxy-2,4-dimethoxybenzenepropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
