CAS 1068149-94-9
:(S)-1,5-dimethylpiperazin-2-one
Description:
(S)-1,5-dimethylpiperazin-2-one is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms at opposite positions. This compound features two methyl groups attached to the first and fifth carbon atoms of the piperazine ring, contributing to its unique properties. The presence of the carbonyl group (C=O) at the second position classifies it as a piperazinone, which can influence its reactivity and potential applications in medicinal chemistry. The stereochemistry indicated by the "(S)" designation suggests that the compound has a specific spatial arrangement of its atoms, which can significantly affect its biological activity and interactions with other molecules. Generally, compounds like (S)-1,5-dimethylpiperazin-2-one may exhibit properties such as solubility in polar solvents, potential for hydrogen bonding, and the ability to act as a ligand in various chemical reactions. Its specific applications and behavior would depend on further studies, particularly in the context of drug development or synthesis.
Formula:C6H12N2O
InChI:InChI=1S/C6H12N2O/c1-5-4-8(2)6(9)3-7-5/h5,7H,3-4H2,1-2H3/t5-/m0/s1
SMILES:C[C@H]1CN(C)C(=O)CN1
Synonyms:- 2-Piperazinone, 1,5-dimethyl-, (5S)-
- (5S)-1,5-dimethylpiperazin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
