
CAS 1068149-99-4
:1-Ethyl-5,5-dimethyl-2-piperazinone
Description:
1-Ethyl-5,5-dimethyl-2-piperazinone is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features an ethyl group and two methyl groups attached to the piperazine, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the piperazinone moiety suggests that it may exhibit basic properties and can participate in hydrogen bonding due to the nitrogen atoms. This compound is of interest in various fields, including medicinal chemistry, where it may serve as a building block for pharmaceuticals or agrochemicals. Its solubility in organic solvents and potential reactivity with electrophiles or nucleophiles make it a versatile intermediate in synthetic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H16N2O
InChI:InChI=1S/C8H16N2O/c1-4-10-6-8(2,3)9-5-7(10)11/h9H,4-6H2,1-3H3
InChI key:InChIKey=WYXRKOIAGFAGOP-UHFFFAOYSA-N
SMILES:C(C)N1CC(C)(C)NCC1=O
Synonyms:- 1-Ethyl-5,5-dimethyl-2-piperazinone
- 2-Piperazinone, 1-ethyl-5,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.