CAS 106825-79-0

(S)-morpholine-3-carboxylic acid

Description:

(S)-Morpholine-3-carboxylic acid, with the CAS number 106825-79-0, is an organic compound characterized by its morpholine ring structure, which is a six-membered heterocycle containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 3-position of the morpholine ring, contributing to its acidic properties. As a chiral molecule, it exists in two enantiomeric forms, with the (S)-configuration being the biologically active form. This compound is often utilized in pharmaceutical research and synthesis due to its potential as a building block for various bioactive molecules. Its solubility in water and polar organic solvents makes it suitable for various chemical reactions and applications. Additionally, (S)-morpholine-3-carboxylic acid may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₉NO₃

InChI: InChI=1/C5H9NO3/c7-5(8)4-3-9-2-1-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1

SMILES: C1COC[C@@H](C(=O)O)N1

Synonyms:

• (3S)-Morpholine-3-carboxylic acid
• 3-Morpholinecarboxylic acid, (3S)-
• acide (3S)-morpholine-3-carboxylique
• (S)-3-Morpholinecarboxylic Acid Hcl

(S)-Morpholine-3-carboxylic acid

CAS: 106825-79-0

Formula: C₅H₉NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 131.1299

Ref: IN-DA003CM4

(3S)-Morpholine-3-carboxylic acid

CAS: 106825-79-0

(3S)-Morpholine-3-carboxylic acid

Purity: 95%

Molecular weight: 131.13g/mol

Ref: 54-OR308162

(S)-Morpholine-3-carboxylic acid

CAS: 106825-79-0

Formula: C₅H₉NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 131.131

Ref: 10-F208785