CAS 106827-27-4

5-(3,5-Dichlorophenyl)-2-furancarboxaldehyde

Description:

5-(3,5-Dichlorophenyl)-2-furancarboxaldehyde is an organic compound characterized by its unique structure, which includes a furan ring and a dichlorophenyl group. This compound features a furan moiety, a five-membered aromatic ring containing oxygen, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 3,5-dichlorophenyl substituent enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic additions and substitutions. The aldehyde functional group (-CHO) is also significant, as it can participate in condensation reactions and serve as a precursor for further chemical transformations. This compound is typically used in research and development, particularly in the synthesis of pharmaceuticals and agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, 5-(3,5-Dichlorophenyl)-2-furancarboxaldehyde is a versatile building block in organic chemistry with potential applications in various fields.

Formula: C₁₁H₆Cl₂O₂

InChI: InChI=1S/C11H6Cl2O2/c12-8-3-7(4-9(13)5-8)11-2-1-10(6-14)15-11/h1-6H

InChI key: InChIKey=IYMCMUBLJQRCBD-UHFFFAOYSA-N

SMILES: C(=O)C=1OC(=CC1)C2=CC(Cl)=CC(Cl)=C2

Synonyms:

• 5-(3,5-Dichlorophenyl)furan-2-carboxaldehyde
• 5-(3,5-Dichlorophenyl)-2-furancarboxaldehyde
• 2-Furancarboxaldehyde, 5-(3,5-dichlorophenyl)-