CAS 106841-04-7: (3-amino-4-chlorophenyl)(4-methylphenyl)methanone

Description:(3-amino-4-chlorophenyl)(4-methylphenyl)methanone, with the CAS number 106841-04-7, is an organic compound characterized by its distinct functional groups and structural features. It contains an amine group (-NH2), a chlorophenyl group, and a ketone functional group (C=O) attached to a phenyl ring. The presence of the amino group suggests potential for hydrogen bonding and reactivity in various chemical reactions, while the chlorophenyl moiety may influence its electronic properties and solubility. The methyl group on the phenyl ring can affect steric hindrance and overall molecular stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its functional groups and overall molecular architecture, which are essential for understanding its behavior in different environments.

Formula:C₁₄H₁₂ClNO

InChI:InChI=1/C14H12ClNO/c1-9-2-4-10(5-3-9)14(17)11-6-7-12(15)13(16)8-11/h2-8H,16H2,1H3

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	(3-amino-4-chlorophenyl)(4-methylphenyl)methanone REF: 10-F316200CAS: 106841-04-7	95.0%	To inquire	Mon 05 May 25
	(3-Amino-4-chlorophenyl)(4-methylphenyl)methanone REF: 3D-GEA84104CAS: 106841-04-7	Min. 95%	- - -	Discontinued product