CAS 106848-88-8

(-)-Desethylchloroquine

Description:

(-)-Desethylchloroquine is a chemical compound that is a derivative of chloroquine, primarily known for its use in the treatment of malaria and certain autoimmune diseases. It is characterized by its chiral nature, with the "(-)" prefix indicating its specific stereoisomer, which can influence its biological activity and pharmacokinetics. The compound has a molecular structure that includes a quinoline ring, which is essential for its antimalarial properties, and an ethyl side chain that has been modified from the parent chloroquine structure. (-)-Desethylchloroquine exhibits moderate solubility in organic solvents and is less soluble in water, which can affect its bioavailability. Its mechanism of action involves interference with the heme detoxification process in the malaria parasite, leading to its death. Additionally, the compound has been studied for its potential antiviral properties, particularly against certain viral infections. As with many pharmaceuticals, understanding its pharmacodynamics and pharmacokinetics is crucial for optimizing its therapeutic use and minimizing potential side effects.

Formula: C₁₆H₂₂ClN₃

InChI: InChI=1S/C16H22ClN3/c1-3-18-9-4-5-12(2)20-15-8-10-19-16-11-13(17)6-7-14(15)16/h6-8,10-12,18H,3-5,9H2,1-2H3,(H,19,20)/t12-/m1/s1

InChI key: InChIKey=MCYUUUTUAAGOOT-GFCCVEGCSA-N

SMILES: N([C@@H](CCCNCC)C)C=1C2=C(N=CC1)C=C(Cl)C=C2

Synonyms:

• 1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1-ethyl-, (R)-
• 1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1-ethyl-, (4R)-
• (-)-Desethylchloroquine
• (4R)-N4-(7-Chloro-4-quinolinyl)-N1-ethyl-1,4-pentanediamine
• (R)-Desethylchloroquine

(R)-Desethylchloroquine

Controlled Product

CAS: 106848-88-8

Formula: C₁₆H₂₂ClN₃

Color and Shape: Neat

Molecular weight: 291.819

Ref: TR-D289098