CymitQuimica logo

CAS 106850-18-4

:

Methyl 4,5-diamino-2-thiophenecarboxylate

Description:
Methyl 4,5-diamino-2-thiophenecarboxylate is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features two amino groups (-NH2) at the 4 and 5 positions of the thiophene ring, contributing to its potential reactivity and ability to form hydrogen bonds. The presence of a carboxylate group (-COOCH3) indicates that it is an ester, specifically a methyl ester, which can influence its solubility and reactivity in various chemical environments. Methyl 4,5-diamino-2-thiophenecarboxylate may exhibit biological activity, making it of interest in pharmaceutical research and development. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound's unique structure and functional groups make it a valuable subject for further study in organic synthesis and medicinal chemistry.
Formula:C6H8N2O2S
InChI:InChI=1/C6H8N2O2S/c1-10-6(9)4-2-3(7)5(8)11-4/h2H,7-8H2,1H3
SMILES:COC(=O)c1cc(c(N)s1)N
Synonyms:
  • 2-Thiophenecarboxylic acid, 4,5-diamino-, methyl ester
  • Methyl 4,5-Diaminothiophene-2-Carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.