CAS 106850-34-4
:Imidazo[1,2-a]pyridine-6-carbonitrile
Description:
Imidazo[1,2-a]pyridine-6-carbonitrile is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a cyano group (-C≡N) at the 6-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits a pale yellow to off-white crystalline appearance and has a relatively high melting point, indicative of strong intermolecular interactions. It is known for its potential applications in medicinal chemistry, particularly as a scaffold for developing bioactive molecules, due to its ability to interact with various biological targets. The compound's structure allows for diverse functionalization, making it a versatile intermediate in organic synthesis. Additionally, its stability under standard laboratory conditions makes it suitable for various chemical reactions. Overall, Imidazo[1,2-a]pyridine-6-carbonitrile is a significant compound in the field of pharmaceuticals and materials science, with ongoing research into its properties and applications.
Formula:C8H5N3
InChI:InChI=1/C8H5N3/c9-5-7-1-2-8-10-3-4-11(8)6-7/h1-4,6H
SMILES:c1cc2nccn2cc1C#N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Cyanoimidazo[1,2-a]pyridine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H5N3Purity:95%Color and Shape:Powder, CreamMolecular weight:143.15Imidazo[1,2-a]pyridine-6-carbonitrile
CAS:Formula:C8H5N3Purity:97%Color and Shape:SolidMolecular weight:143.1454Imidazo[1,2-a]pyridine-6-carbonitrile
CAS:Imidazo[1,2-a]pyridine-6-carbonitrileFormula:C8H5N3Purity:97%Color and Shape: light brown solidMolecular weight:143.15g/molImidazo[1,2-a]pyridine-6-carbonitrile
CAS:Formula:C8H5N3Purity:97%Color and Shape:SolidMolecular weight:143.149



