CAS 106851-53-0: 2-(2-Bromophenyl)thiophene

Description:2-(2-Bromophenyl)thiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a bromophenyl substituent at the second position of the thiophene ring, contributing to its unique chemical properties. It typically appears as a solid at room temperature and is known for its potential applications in organic electronics, particularly in organic semiconductors and photovoltaic devices. The presence of the bromine atom enhances its reactivity, making it suitable for various chemical transformations. Additionally, the compound exhibits interesting electronic properties due to the conjugation between the thiophene and the bromophenyl moiety, which can influence its optical characteristics. Its solubility in organic solvents allows for ease of handling in laboratory settings. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2-(2-Bromophenyl)thiophene is a significant compound in the field of organic chemistry and materials science.

Formula:C₁₀H₇BrS

InChI:InChI=1/C10H7BrS/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-7H

Synonyms:
2-(2'Bromopheny)Thiophene

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-(2-BROMOPHENYL)THIOPHENE REF: IN-DA008RQNCAS: 106851-53-0	- - -	To inquire	Tue 22 Apr 25
2-(2-Bromophenyl)thiophene REF: 54-OR1422CAS: 106851-53-0	95%	170.00 €	Tue 29 Apr 25
2-(2-Bromophenyl)thiophene REF: 10-F092477CAS: 106851-53-0	95.0%	To inquire	Wed 30 Apr 25
2-(2-Bromophenyl)thiophene REF: 3D-FB155190CAS: 106851-53-0	Min. 95%	- - -	Discontinued product