CAS 106854-78-8

1-Chloro-3-(2,2,2-trifluoroethoxy)benzene

Description:

1-Chloro-3-(2,2,2-trifluoroethoxy)benzene is an organic compound characterized by the presence of a chloro group and a trifluoroethoxy substituent on a benzene ring. Its molecular structure features a chlorine atom attached to the third carbon of the benzene ring, while the trifluoroethoxy group is attached to the first carbon. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is known for its relatively low solubility in water but higher solubility in organic solvents, which is common for halogenated aromatic compounds. The trifluoroethoxy group imparts unique properties, such as increased hydrophobicity and potential applications in various chemical syntheses and as an intermediate in the production of agrochemicals or pharmaceuticals. Additionally, the presence of chlorine and fluorine atoms can influence the compound's reactivity and stability, making it of interest in both industrial and research settings. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.

Formula: C₈H₆ClF₃O

InChI: InChI=1S/C8H6ClF3O/c9-6-2-1-3-7(4-6)13-5-8(10,11)12/h1-4H,5H2

InChI key: InChIKey=WHVAPZOZERQFSI-UHFFFAOYSA-N

SMILES: O(CC(F)(F)F)C1=CC(Cl)=CC=C1

Synonyms:

• Benzene, 1-chloro-3-(2,2,2-trifluoroethoxy)-
• 1-Chloro-3-(2,2,2-trifluoroethoxy)benzene