CAS 106867-97-4: 1,1'-[1,4-PHENYLENEBIS(METHYLENE)]BIS(4,4'-BIPYRIDINIUM) DIBROMIDE
Description:1,1'-[1,4-Phenylenebis(methylene)]bis(4,4'-bipyridinium) dibromide, with CAS number 106867-97-4, is a synthetic organic compound characterized by its complex structure, which includes bipyridinium units linked by a phenylene group. This compound typically exhibits properties associated with ionic salts, such as high solubility in polar solvents and the ability to form stable complexes with various anions. The presence of bipyridinium moieties imparts notable electrochemical properties, making it of interest in applications such as electrochemistry and materials science. Additionally, the dibromide form indicates that it contains two bromide ions, contributing to its ionic character. The compound may also exhibit interesting photophysical properties, which can be leveraged in dye-sensitized solar cells or as a fluorescent probe. Its structural features suggest potential applications in molecular electronics and as a building block for supramolecular chemistry. Overall, this compound is significant in research contexts due to its unique properties and potential applications in advanced materials.
Formula:C28H24Br2N4
InChI:InChI=1/C28H24N4.2BrH/c1-2-24(22-32-19-11-28(12-20-32)26-7-15-30-16-8-26)4-3-23(1)21-31-17-9-27(10-18-31)25-5-13-29-14-6-25;;/h1-20H,21-22H2;2*1H/q+2;;/p-2
- Synonyms:
- 1,1'-(P-Xylylene)Bis(4,4'-Bipyridinium) Dibromide

1,1''-(1,4-Phenylenebis(methylene))bis(([4,4'-bipyridin]-1-ium)) bromide
Ref: IN-DA003D6S
100mg | 98.00 € |

1,1'-[1,4-Phenylenebis(methylene)]bis(4,4'-bipyridinium) Dibromide
Ref: 3B-P1405
100mg | 84.00 € |

1,1'-[1,4-Phenylenebis(methylene)]bis(4,4'-bipyridinium) Dibromide
Ref: 3D-GEA86797
1g | Discontinued | Request information | |
5g | Discontinued | Request information |