CAS 106877-22-9

3,6-Bis(trifluoromethyl)benzene-1,2-diamine

Description:

3,6-Bis(trifluoromethyl)benzene-1,2-diamine, with the CAS number 106877-22-9, is an organic compound characterized by the presence of two amino groups (-NH2) and two trifluoromethyl groups (-CF3) attached to a benzene ring. This compound exhibits significant polarity due to the electronegative fluorine atoms, which can influence its reactivity and solubility in various solvents. The trifluoromethyl groups enhance the compound's lipophilicity and can also impart unique electronic properties, making it of interest in materials science and medicinal chemistry. The amino groups provide sites for potential hydrogen bonding, which can affect the compound's interactions with other molecules. Additionally, the presence of multiple functional groups suggests that this compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 3,6-Bis(trifluoromethyl)benzene-1,2-diamine is a versatile compound with applications in research and development, particularly in the synthesis of more complex organic molecules.

Formula: C₈H₆F₆N₂

InChI: InChI=1S/C8H6F6N2/c9-7(10,11)3-1-2-4(8(12,13)14)6(16)5(3)15/h1-2H,15-16H2

InChI key: InChIKey=YCMVMJWWGVVLDD-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(N)C(N)=C(C(F)(F)F)C=C1

Synonyms:

• 1,2-Benzenediamine, 3,6-bis(trifluoromethyl)-
• 3,6-Bis(trifluoromethyl)benzene-1,2-diamine
• 3,6-Bis(trifluoromethyl)-1,2-benzenediamine

3,6-Bis(trifluoromethyl)benzene-1,2-diamine

Controlled Product

CAS: 106877-22-9

Formula: C₈H₆F₆N₂

Color and Shape: Neat

Molecular weight: 244.137

Ref: TR-B121800