CAS 106877-30-9: 3-Methyl-2-(trifluoromethyl)benzenamine
Description:3-Methyl-2-(trifluoromethyl)benzenamine, also known by its CAS number 106877-30-9, is an organic compound characterized by the presence of an amino group (-NH2) attached to a benzene ring that also features a methyl group and a trifluoromethyl group. The molecular structure indicates that it is a substituted aniline, where the trifluoromethyl group significantly influences its chemical properties, including increased lipophilicity and potential reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the trifluoromethyl group. The presence of the amino group allows for potential hydrogen bonding, which can affect its reactivity and interaction with other chemical species. 3-Methyl-2-(trifluoromethyl)benzenamine may be used in various applications, including pharmaceuticals and agrochemicals, due to its unique electronic and steric properties. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C8H8F3N
InChI:InChI=1S/C8H8F3N/c1-5-3-2-4-6(12)7(5)8(9,10)11/h2-4H,12H2,1H3
InChI key:InChIKey=MBTVXHHLADNUCN-UHFFFAOYSA-N
SMILES:FC(F)(F)C=1C(N)=CC=CC1C
- Synonyms:
- 2-Trifluoromethyl-3-methylaniline
- 3-Methyl-2-(trifluoromethyl)benzenamine
- 3-Methyl-2-trifluoromethylaniline
- 3-Methyl-2-trifluoromethyl-phenylamine
- Benzenamine, 3-methyl-2-(trifluoromethyl)-
3-Methyl-2-trifluoromethyl-phenylamine
Ref: IN-DA019DCC
| 1g | To inquire | ||
| 50mg | 200.00 € | ||
| 100mg | 187.00 € | ||
| 250mg | 317.00 € |
Ref: 54-PC102288
| 1g | 1,131.00 € | ||
| 100mg | 209.00 € | ||
| 250mg | 302.00 € |
Ref: 10-F606936
| 1g | To inquire | ||
| 100mg | 112.00 € | ||
| 250mg | 167.00 € |
3-Methyl-2-(trifluoromethyl)aniline
Ref: 3D-GEA87730
| 50mg | 550.00 € | ||
| 500mg | 1,503.00 € |
