CAS 106877-33-2
:5-Amino-2-(trifluoromethyl)pyridine
Description:
5-Amino-2-(trifluoromethyl)pyridine is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a pyridine ring. Its molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The trifluoromethyl group significantly influences the compound's electronic properties, enhancing its lipophilicity and potentially affecting its interactions in biological systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. It is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential as a building block in the synthesis of more complex molecules. The presence of both the amino and trifluoromethyl groups can impart unique reactivity patterns, making it a valuable intermediate in the development of pharmaceuticals and other functional materials. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit specific toxicological properties.
Formula:C6H5F3N2
InChI:InChI=1/C6H5F3N2/c7-6(8,9)5-2-1-4(10)3-11-5/h1-3H,10H2
SMILES:c1cc(C(F)(F)F)ncc1N
Synonyms:- 6-(Trifluoromethyl)Pyridin-3-Amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Amino-2-(trifluoromethyl)pyridine
CAS:Formula:C6H5F3N2Purity:>98.0%(GC)(T)Color and Shape:White to Brown powder to crystallineMolecular weight:162.125-Amino-2-(trifluoromethyl)pyridine, 98%
CAS:Employed in a convenient, one-pot, synthesis of azaindoles. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference hasFormula:C6H5F3N2Purity:98%Molecular weight:162.115-Amino-2-(trifluoromethyl)pyridine
CAS:Formula:C6H5F3N2Purity:95%Color and Shape:SolidMolecular weight:162.11255-Amino-2-(trifluoromethyl)pyridine
CAS:5-Amino-2-(trifluoromethyl)pyridineFormula:C6H5F3N2Purity:98%Color and Shape: low melting solidMolecular weight:162.11g/mol5-Amino-2-(trifluoromethyl)pyridine
CAS:Formula:C6H5F3N2Purity:97.0%Color and Shape:SolidMolecular weight:162.115





