CAS 106877-45-6

3-Amino-2-(trifluoromethyl)phenol

Description:

3-Amino-2-(trifluoromethyl)phenol is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a phenolic ring. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The amino group (-NH2) contributes to its basicity and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The trifluoromethyl group (-CF3) enhances the compound's lipophilicity and can influence its biological activity, making it a subject of interest in medicinal chemistry. Additionally, the presence of both functional groups can lead to unique properties, such as increased stability and altered solubility in different solvents. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 3-Amino-2-(trifluoromethyl)phenol is a versatile compound with significant implications in chemical research and development.

Formula: C₇H₆F₃NO

InChI: InChI=1S/C7H6F3NO/c8-7(9,10)6-4(11)2-1-3-5(6)12/h1-3,12H,11H2

InChI key: InChIKey=RUNYOYJSBYNOMZ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(N)C=CC=C1O

Synonyms:

• 3-Amino-2-(trifluoromethyl)phenol
• 2-Trifluoromethyl-3-aminophenol
• Phenol, 3-amino-2-(trifluoromethyl)-