CAS 106882-29-5

[3-(thiophene-2-carbonyl)phenyl] acetate

Description:

[3-(Thiophene-2-carbonyl)phenyl] acetate, with the CAS number 106882-29-5, is an organic compound characterized by its unique structure that includes a thiophene ring and an acetate functional group. This compound typically exhibits a moderate to high degree of lipophilicity due to the presence of aromatic systems, which can influence its solubility in organic solvents. The thiophene moiety contributes to its potential electronic properties, making it of interest in various applications, including organic electronics and pharmaceuticals. The carbonyl group attached to the thiophene enhances its reactivity, allowing for potential interactions in chemical synthesis or biological activity. Additionally, the acetate group can participate in esterification reactions, further expanding its utility in synthetic chemistry. Overall, this compound's structural features suggest it may possess interesting chemical reactivity and biological properties, warranting further investigation in research and development contexts.

Formula: C₁₃H₁₀O₃S

InChI: InChI=1/C13H10O3S/c1-9(14)16-11-5-2-4-10(8-11)13(15)12-6-3-7-17-12/h2-8H,1H3

SMILES: CC(=O)Oc1cccc(c1)C(=O)c1cccs1

2-(3-Acetoxybenzoyl) thiophene

CAS: 106882-29-5

Formula: C₁₃H₁₀O₃S

Purity: 90.0%

Molecular weight: 246.28

Ref: 10-F202765