CAS 106882-30-8

[4-(Acetyloxy)phenyl]-2-thienylmethanone

Description:

[4-(Acetyloxy)phenyl]-2-thienylmethanone, with the CAS number 106882-30-8, is an organic compound characterized by its unique structural features, which include a phenyl ring substituted with an acetyloxy group and a thienyl group attached to a carbonyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The acetyloxy group can enhance solubility in organic solvents and may influence the compound's reactivity in various chemical reactions, including esterification and nucleophilic substitution. The thienyl moiety contributes to the compound's electronic properties, potentially allowing for applications in organic electronics or as a building block in synthetic chemistry. Additionally, compounds with similar structures may exhibit biological activity, making them of interest in pharmaceutical research. Overall, [4-(Acetyloxy)phenyl]-2-thienylmethanone represents a versatile structure with potential applications in various fields of chemistry and materials science.

Formula: C₁₃H₁₀O₃S

InChI: InChI=1/C13H10O3S/c1-9(14)16-11-6-4-10(5-7-11)13(15)12-3-2-8-17-12/h2-8H,1H3

InChI key: InChIKey=DBKNRDYNXMZHRK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC(C)=O)C=C1)C2=CC=CS2

Synonyms:

• [4-(Acetyloxy)phenyl]-2-thienylmethanone
• Ketone, p-hydroxyphenyl 2-thienyl, acetate
• 2-(4-Acetoxybenzoyl) thiophene
• Methanone, [4-(acetyloxy)phenyl]-2-thienyl-