CAS 106898-35-5

[[3,5-Bis(trifluoromethyl)phenyl]methyl]hydrazine

Description:

[[3,5-Bis(trifluoromethyl)phenyl]methyl]hydrazine, with the CAS number 106898-35-5, is a chemical compound characterized by its hydrazine functional group attached to a phenyl ring that is further substituted with two trifluoromethyl groups at the 3 and 5 positions. This structure imparts significant lipophilicity and potential reactivity, making it of interest in various chemical applications, including as a building block in organic synthesis and potentially in pharmaceuticals. The presence of trifluoromethyl groups enhances the compound's stability and alters its electronic properties, which can influence its reactivity and interaction with biological systems. Additionally, compounds with hydrazine moieties are often investigated for their potential as reducing agents or in the synthesis of more complex molecules. However, due to the presence of hydrazine, which is known for its toxicity and potential health hazards, handling and usage require careful consideration of safety protocols. Overall, this compound exemplifies the intersection of organic chemistry and material science, with implications in both research and industrial applications.

Formula: C₉H₈F₆N₂

InChI: InChI=1S/C9H8F6N2/c10-8(11,12)6-1-5(4-17-16)2-7(3-6)9(13,14)15/h1-3,17H,4,16H2

InChI key: InChIKey=SKCQHPUOBZJWOY-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(C(F)(F)F)=CC(CNN)=C1

Synonyms:

• Hydrazine, [[3,5-bis(trifluoromethyl)phenyl]methyl]-
• 3,5-Ditrifluoromethyl-benzyl-hydrazine
• [[3,5-Bis(trifluoromethyl)phenyl]methyl]hydrazine