CAS 106898-72-0

2-(Cyclohexylamino)benzenemethanol

Description:

2-(Cyclohexylamino)benzenemethanol, with the CAS number 106898-72-0, is an organic compound characterized by the presence of a cyclohexylamino group attached to a benzene ring, which is further substituted with a hydroxymethyl group. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group, while the cyclohexyl group may impart hydrophobic characteristics. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications. Safety data should also be consulted to understand any hazards associated with handling this compound.

Formula: C₁₃H₁₉NO

InChI: InChI=1S/C13H19NO/c15-10-11-6-4-5-9-13(11)14-12-7-2-1-3-8-12/h4-6,9,12,14-15H,1-3,7-8,10H2

InChI key: InChIKey=LAJAQHGRIOIMGK-UHFFFAOYSA-N

SMILES: N(C1=C(CO)C=CC=C1)C2CCCCC2

Synonyms:

• [2-(Cyclohexylamino)phenyl]methanol
• Benzenemethanol, 2-(cyclohexylamino)-
• 2-(Cyclohexylamino)benzyl alcohol
• 2-(Cyclohexylamino)benzenemethanol