CAS 1069-53-0: 2,3,5-Trimethylhexane

Description:2,3,5-Trimethylhexane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C11H24, indicating it consists of 11 carbon atoms and 24 hydrogen atoms. This compound is characterized by its branched structure, which contributes to its physical properties, such as a relatively low boiling point compared to straight-chain alkanes of similar molecular weight. 2,3,5-Trimethylhexane is a colorless liquid at room temperature and is insoluble in water but soluble in organic solvents. It is primarily used as a reference standard in octane rating tests due to its high octane number, making it valuable in the petroleum industry. Additionally, it exhibits typical alkane properties, such as being non-polar and having low reactivity under standard conditions. Its presence in gasoline formulations helps improve fuel performance. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it can be flammable and may pose health risks upon prolonged exposure.

Formula:C₉H₂₀

InChI:InChI=1S/C9H20/c1-7(2)6-9(5)8(3)4/h7-9H,6H2,1-5H3

InChI key:InChIKey=ODGLTLJZCVNPBU-UHFFFAOYSA-N

SMILES:CC(C)CC(C)C(C)C