CAS 1069068-09-2

2-Fluoro-3-hydroxyphenylalanine

Description:

2-Fluoro-3-hydroxyphenylalanine is an amino acid derivative characterized by the presence of a fluorine atom and a hydroxyl group on the phenyl ring of the phenylalanine structure. This compound features a chiral center, which contributes to its potential biological activity and interactions. The fluorine substitution can influence the compound's lipophilicity and metabolic stability, making it of interest in medicinal chemistry and drug design. The hydroxyl group may participate in hydrogen bonding, affecting the compound's solubility and reactivity. As a modified amino acid, 2-Fluoro-3-hydroxyphenylalanine can be utilized in various biochemical applications, including studies of protein structure and function, as well as in the development of pharmaceuticals targeting specific biological pathways. Its unique structural features may also allow for the exploration of its role in enzyme catalysis or receptor binding, providing insights into the mechanisms of action of related compounds. Overall, this substance represents a valuable tool in both research and therapeutic contexts.

Formula: C₉H₁₀FNO₃

InChI: InChI=1S/C9H10FNO3/c10-8-5(2-1-3-7(8)12)4-6(11)9(13)14/h1-3,6,12H,4,11H2,(H,13,14)

InChI key: InChIKey=VMIZXNIWIKTWDQ-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)N)C1=C(F)C(O)=CC=C1

Synonyms:

• Phenylalanine, 2-fluoro-3-hydroxy-
• 2-Fluoro-3-hydroxyphenylalanine