CAS 1069090-27-2

(4S)-3-Methyl-2-oxo-4-imidazolidinecarboxylic acid

Description:

(4S)-3-Methyl-2-oxo-4-imidazolidinecarboxylic acid, identified by its CAS number 1069090-27-2, is a chemical compound characterized by its imidazolidine ring structure, which contributes to its unique properties. This compound features a chiral center, indicated by the (4S) designation, which implies that it exists in a specific stereoisomeric form. The presence of a methyl group and a carboxylic acid functional group enhances its reactivity and solubility in polar solvents. The keto group (2-oxo) suggests potential for tautomerization and reactivity in various chemical reactions, including nucleophilic attacks. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its structural features suggest potential applications in medicinal chemistry, particularly in the design of bioactive molecules. Overall, (4S)-3-Methyl-2-oxo-4-imidazolidinecarboxylic acid is a compound with intriguing chemical properties that warrant further investigation for its potential uses in various scientific fields.

Formula: C₅H₈N₂O₃

InChI: InChI=1S/C5H8N2O3/c1-7-3(4(8)9)2-6-5(7)10/h3H,2H2,1H3,(H,6,10)(H,8,9)/t3-/m0/s1

InChI key: InChIKey=ZYYGFIXCFRITFC-VKHMYHEASA-N

SMILES: C(O)(=O)[C@H]1N(C)C(=O)NC1

Synonyms:

• 4-Imidazolidinecarboxylic acid, 3-methyl-2-oxo-, (4S)-
• (4S)-3-Methyl-2-oxo-4-imidazolidinecarboxylic acid
• (S)-3-Methyl-2-oxoimidazolidine-4-carboxylic acid