CymitQuimica logo

CAS 106920-29-0

:

TPT-TTF

Description:
TPT-TTF, or tetrathiafulvalene, is a chemical compound known for its unique electronic properties, making it significant in the field of organic electronics and materials science. It features a structure that includes a tetrathiafulvalene core, which consists of a conjugated system of sulfur and carbon atoms. This compound is characterized by its ability to undergo oxidation, forming stable radical cations, which contributes to its conductivity and potential use in organic semiconductors. TPT-TTF is often studied for its role in charge transfer complexes and its applications in organic photovoltaics and molecular electronics. Additionally, it exhibits interesting magnetic properties and can form various salts with different counterions, further enhancing its versatility in research. Its solubility and stability in various solvents make it suitable for various experimental conditions. Overall, TPT-TTF is a notable compound in the realm of organic materials, with ongoing research exploring its potential applications in advanced electronic devices.
Formula:C26H44S8
InChI:InChI=1/C26H44S8/c1-5-9-13-17-27-21-22(28-18-14-10-6-2)32-25(31-21)26-33-23(29-19-15-11-7-3)24(34-26)30-20-16-12-8-4/h5-20H2,1-4H3
SMILES:CCCCCSC1=C(SCCCCC)SC(=C2SC(=C(SCCCCC)S2)SCCCCC)S1
Synonyms:
  • Tetrakis(N-Pentylthio)Tetrathiafulvalene
  • Tetrakis(Pentylthio)Tetrathiafulvalene
  • Tetrakis(Amylthio)Tetrathiafulvalene
  • Tetrakis(pentylthio)tetrathiafulvalene [Organic Electronic Material]
  • 2-[4,5-Bis(Pentylsulfanyl)-1,3-Dithiol-2-Ylidene]-4,5-Bis(Pentylsulfanyl)-1,3-Dithiole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.