CAS 106930-51-2
:BOC-D-LEUCINOL
Description:
BOC-D-leucinol, with the CAS number 106930-51-2, is a chemical compound characterized by its structure as a derivative of leucine, an essential amino acid. It features a tert-butyloxycarbonyl (BOC) protecting group, which is commonly used in organic synthesis to protect amines during chemical reactions. This compound is typically a white to off-white solid and is soluble in organic solvents such as methanol and dichloromethane, but has limited solubility in water. BOC-D-leucinol is primarily utilized in peptide synthesis and pharmaceutical research, serving as an intermediate in the preparation of various bioactive compounds. Its stability and reactivity make it a valuable building block in the development of peptide-based drugs. Additionally, the presence of the BOC group allows for selective deprotection, facilitating further functionalization of the molecule. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use in laboratory settings.
Formula:C11H23NO3
InChI:InChI=1/C11H23NO3/c1-8(2)6-9(7-13)12-10(14)15-11(3,4)5/h8-9,13H,6-7H2,1-5H3,(H,12,14)/t9-/m1/s1
SMILES:CC(C)C[C@H](CO)N=C(O)OC(C)(C)C
Synonyms:- (R)-N-(T-Butoxycarbonyl)-Leucinol
- R(+)-2-(Boc-Amino)-4-Methyl-1-Pentanol
- N-T-Butoxycarbonyl-D-Leucinol
- N-T-Boc-D-Leucinol
- N-Alpha-T-Boc-D-Leucinol
- N-Boc-D-Leucinol
- Boc-(R)-2-Amino-4-Methyl-1-Pentanol
- tert-butyl [(1R)-1-(hydroxymethyl)-3-methylbutyl]carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Boc-D-leucinol, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H23NO3Purity:98%Molecular weight:217.31
