CAS 106946-74-1
:N-Boc-L-isolucinole
Description:
N-Boc-L-isolucinole, with the CAS number 106946-74-1, is a chemical compound that belongs to the class of amino acids and is characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group. This compound is an analog of L-isoleucine, an essential amino acid, and is often utilized in peptide synthesis and medicinal chemistry due to its ability to protect the amino group during chemical reactions. The Boc group enhances the stability and solubility of the molecule, making it easier to handle in various synthetic processes. N-Boc-L-isolucinole typically exhibits properties such as chirality, as it contains a stereocenter, which is crucial for its biological activity. Additionally, it is soluble in organic solvents, which facilitates its use in laboratory settings. The compound's structure allows for further modifications, making it a valuable intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals and biologically active compounds.
Formula:C11H23NO3
InChI:InChI=1/C11H23NO3/c1-6-8(2)9(7-13)12-10(14)15-11(3,4)5/h8-9,13H,6-7H2,1-5H3,(H,12,14)/t8?,9-/m1/s1
SMILES:CCC(C)[C@@H](CO)N=C(O)OC(C)(C)C
Synonyms:- Boc-Isoleucinol
- Boc-L-isoleucinol
- N-t-BOC-L-Isoleucinol
- N-Boc-L-isoleucinol
- Boc-(2S,3S)-2-amino-3-methyl-1-pentanol
- N-Boc-(2S)-Amino-(3S)-methyl-1-pentanol
- N-(tert-Butoxycarbonyl)-L-isoleucinol
- N-(2S)-Amino-(3S)-methyl-1-pentanol
- tert-butyl N-[(1S)-1-(hydroxymethyl)-2-methyl-butyl]carbamate
- N-Boc-(2S,3S)-(-)-2-Amino-3-Methyl-1-Pentanol
- Boc-Ile-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Boc-L-isoleucinol, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H23NO3Purity:95%Color and Shape:Clear colorless, Viscous liquidMolecular weight:217.31N-Boc-(2S,3S)-(-)-2-Amino-3-Methyl-1-Pentanol
CAS:N-Boc-(2S,3S)-(-)-2-Amino-3-Methyl-1-PentanolPurity:97%Molecular weight:217.31g/mol



