CymitQuimica logo

CAS 106946-96-7

:

Tricyclo[3.3.1.13,7]dec-1-ylmethyl sulfamate

Description:
Tricyclo[3.3.1.1^3,7]dec-1-ylmethyl sulfamate, with the CAS number 106946-96-7, is a chemical compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. This compound features a sulfamate functional group, which is derived from sulfuric acid and is known for its potential applications in medicinal chemistry and as a building block in organic synthesis. The presence of the sulfamate group often imparts properties such as increased solubility and reactivity, making it useful in various chemical reactions. The tricyclic framework contributes to the compound's rigidity and stability, influencing its physical and chemical properties. Additionally, the specific arrangement of atoms within the tricyclic system can affect its biological activity, making it a subject of interest in drug development. Overall, Tricyclo[3.3.1.1^3,7]dec-1-ylmethyl sulfamate exemplifies the complexity and diversity of organic compounds, showcasing the interplay between structure and function in chemistry.
Formula:C11H19NO3S
InChI:InChI=1S/C11H19NO3S/c12-16(13,14)15-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-7H2,(H2,12,13,14)
InChI key:InChIKey=WQYVONSVMMUQTA-UHFFFAOYSA-N
SMILES:C(OS(N)(=O)=O)C12CC3CC(C1)CC(C2)C3
Synonyms:
  • Tricyclo[3.3.1.13,7]dec-1-ylmethyl sulfamate
  • (Adamantan-1-yl)methyl sulfamate
  • Sulfamic acid, tricyclo[3.3.1.13,7]dec-1-ylmethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.