CymitQuimica logo

CAS 1069473-58-0

:

1-(3-Phenyl-2-pyrazinyl)-4-piperidinemethanamine

Description:
1-(3-Phenyl-2-pyrazinyl)-4-piperidinemethanamine, identified by its CAS number 1069473-58-0, is a chemical compound that features a complex structure comprising a piperidine ring and a pyrazine moiety substituted with a phenyl group. This compound is characterized by its potential biological activity, which may include interactions with various receptors or enzymes, making it of interest in medicinal chemistry and pharmacology. The presence of the piperidine ring suggests possible applications in the development of psychoactive or therapeutic agents. Additionally, the pyrazine and phenyl substituents can influence the compound's lipophilicity, solubility, and overall pharmacokinetic properties. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C16H20N4
InChI:InChI=1S/C16H20N4/c17-12-13-6-10-20(11-7-13)16-15(18-8-9-19-16)14-4-2-1-3-5-14/h1-5,8-9,13H,6-7,10-12,17H2
InChI key:InChIKey=WDSGXROHQKKIID-UHFFFAOYSA-N
SMILES:C(N)C1CCN(C=2C(=NC=CN2)C3=CC=CC=C3)CC1
Synonyms:
  • 4-Piperidinemethanamine, 1-(3-phenyl-2-pyrazinyl)-
  • 1-(3-Phenyl-2-pyrazinyl)-4-piperidinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.