CymitQuimica logo

CAS 106961-39-1

:

4-Chloro-2-(trimethylsilyl)thiazole

Description:
4-Chloro-2-(trimethylsilyl)thiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a chlorine substituent at the 4-position and a trimethylsilyl group at the 2-position of the thiazole ring. This structure imparts unique chemical properties, including increased lipophilicity and potential reactivity due to the presence of the chlorine atom and the silyl group. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in various synthetic applications. 4-Chloro-2-(trimethylsilyl)thiazole may also exhibit biological activity, which can be explored in pharmaceutical research. Its CAS number, 106961-39-1, allows for easy identification and retrieval of information regarding its properties, safety data, and potential applications in chemical synthesis and medicinal chemistry. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C6H10ClNSSi
InChI:InChI=1S/C6H10ClNSSi/c1-10(2,3)6-8-5(7)4-9-6/h4H,1-3H3
InChI key:InChIKey=NATNDHYRSAZLPP-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C1=NC(Cl)=CS1
Synonyms:
  • 4-Chloro-2-(trimethylsilyl)thiazole
  • Thiazole, 4-chloro-2-(trimethylsilyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.