CymitQuimica logo

CAS 106976-44-7

:

Benzaldehyde, 2-ethyl-6-methyl- (9CI)

Description:
Benzaldehyde, 2-ethyl-6-methyl- (9CI), with the CAS number 106976-44-7, is an aromatic aldehyde characterized by its distinct structure, which includes a benzene ring substituted with both ethyl and methyl groups. This compound typically exhibits a pleasant, almond-like odor, which is common among many benzaldehyde derivatives. It is a colorless to pale yellow liquid at room temperature and is known for its relatively low boiling point compared to other organic compounds. The presence of the aldehyde functional group (-CHO) contributes to its reactivity, making it susceptible to oxidation and condensation reactions. Benzaldehyde derivatives are often utilized in the synthesis of various organic compounds, including fragrances, flavoring agents, and pharmaceuticals. Additionally, it is soluble in organic solvents but has limited solubility in water. Safety considerations include potential irritant effects on skin and eyes, and appropriate handling measures should be taken to minimize exposure. Overall, this compound is significant in both industrial applications and research contexts.
Formula:C10H12O
InChI:InChI=1S/C10H12O/c1-3-9-6-4-5-8(2)10(9)7-11/h4-7H,3H2,1-2H3
InChI key:QUEDYNFRLQIQHB-UHFFFAOYSA-N
SMILES:CCC1=CC=CC(=C1C=O)C
Found 3 products.